About ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene
ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene (PubChem CID 143987193) has the molecular formula C14H31N3
and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene.
Molecular Properties
| Compound Name | ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene |
| PubChem CID | 143987193 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC.[H]/N=C(\N=C)N(C)[C@@H](C)CCC |
| InChI | InChI=1S/C8H17N3.C4H8.C2H6/c1-5-6-7(2)11(4)8(9)10-3;1-4(2)3;1-2/h7,9H,3,5-6H2,1-2,4H3;1H2,2-3H3;1-2H3/b9-8+;;/t7-;;/m0../s1 |
| InChIKey | OFSQXWLXZAPELY-LZMCAPRFSA-N |
| XLogP | 4.35 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene?
The IUPAC name of ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene (CID 143987193) is ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene.
What is the SMILES notation for ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene?
The canonical SMILES for ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene is C=C(C)C.CC.[H]/N=C(\N=C)N(C)[C@@H](C)CCC.
What is the InChIKey of ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene?
The InChIKey is OFSQXWLXZAPELY-LZMCAPRFSA-N. The full InChI is InChI=1S/C8H17N3.C4H8.C2H6/c1-5-6-7(2)11(4)8(9)10-3;1-4(2)3;1-2/h7,9H,3,5-6H2,1-2,4H3;1H2,2-3H3;1-2H3/b9-8+;;/t7-;;/m0../s1.
What are the key properties of ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene?
ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene has a molecular weight of 241.42 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3-methylidene-1-[(2S)-pentan-2-yl]guanidine;2-methylprop-1-ene is sourced from PubChem (CID 143987193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).