C22H26F3N3O — CID 143988542
2-amino-N-quinolin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;ethane;methane (PubChem CID 143988542) has the molecular formula C22H26F3N3O and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-amino-N-quinolin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;ethane;methane.
| Compound Name | 2-amino-N-quinolin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;ethane;methane |
|---|---|
| PubChem CID | 143988542 |
| Molecular Formula | C22H26F3N3O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-amino-N-quinolin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;ethane;methane |
| SMILES | C.CC.NCC(=O)N(Cc1ccc(C(F)(F)F)cc1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C19H16F3N3O.C2H6.CH4/c20-19(21,22)15-7-5-13(6-8-15)12-25(18(26)10-23)16-9-14-3-1-2-4-17(14)24-11-16;1-2;/h1-9,11H,10,12,23H2;1-2H3;1H4 |
| InChIKey | KVRRFPBEQOUKDI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |