C17H16Cl2N4O — CID 143988961
3-(2-amino-5-methoxyphenyl)-2-(2,5-dichlorophenyl)-5-methylimidazol-4-amine (PubChem CID 143988961) has the molecular formula C17H16Cl2N4O and a molecular weight of 363.25 g/mol. Its IUPAC name is 3-(2-amino-5-methoxyphenyl)-2-(2,5-dichlorophenyl)-5-methylimidazol-4-amine.
| Compound Name | 3-(2-amino-5-methoxyphenyl)-2-(2,5-dichlorophenyl)-5-methylimidazol-4-amine |
|---|---|
| PubChem CID | 143988961 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-(2-amino-5-methoxyphenyl)-2-(2,5-dichlorophenyl)-5-methylimidazol-4-amine |
| SMILES | COc1ccc(N)c(-n2c(-c3cc(Cl)ccc3Cl)nc(C)c2N)c1 |
| InChI | InChI=1S/C17H16Cl2N4O/c1-9-16(21)23(15-8-11(24-2)4-6-14(15)20)17(22-9)12-7-10(18)3-5-13(12)19/h3-8H,20-21H2,1-2H3 |
| InChIKey | QYITVOBPLVYJCK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|