C16H25NO — CID 143989148
(5Z)-4-[(1E)-2-methoxybuta-1,3-dienyl]-1,3-dimethyl-5-pentylidene-2H-pyrrole (PubChem CID 143989148) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (5Z)-4-[(1E)-2-methoxybuta-1,3-dienyl]-1,3-dimethyl-5-pentylidene-2H-pyrrole.
| Compound Name | (5Z)-4-[(1E)-2-methoxybuta-1,3-dienyl]-1,3-dimethyl-5-pentylidene-2H-pyrrole |
|---|---|
| PubChem CID | 143989148 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (5Z)-4-[(1E)-2-methoxybuta-1,3-dienyl]-1,3-dimethyl-5-pentylidene-2H-pyrrole |
| SMILES | C=C/C(=C\C1=C(C)CN(C)/C1=C\CCCC)OC |
| InChI | InChI=1S/C16H25NO/c1-6-8-9-10-16-15(11-14(7-2)18-5)13(3)12-17(16)4/h7,10-11H,2,6,8-9,12H2,1,3-5H3/b14-11+,16-10- |
| InChIKey | YIZAVCQQQQSSFY-UYJJELGDSA-N |
| XLogP | 4.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|