C10H11N5O2 — CID 143989617
5-(1-methyl-8aH-imidazo[1,2-a]pyrimidin-2-yl)imidazolidine-2,4-dione (PubChem CID 143989617) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-(1-methyl-8aH-imidazo[1,2-a]pyrimidin-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-(1-methyl-8aH-imidazo[1,2-a]pyrimidin-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143989617 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 5-(1-methyl-8aH-imidazo[1,2-a]pyrimidin-2-yl)imidazolidine-2,4-dione |
| SMILES | CN1C(C2NC(=O)NC2=O)=CN2C=CC=NC21 |
| InChI | InChI=1S/C10H11N5O2/c1-14-6(7-8(16)13-9(17)12-7)5-15-4-2-3-11-10(14)15/h2-5,7,10H,1H3,(H2,12,13,16,17) |
| InChIKey | QEQCRXLSWUPNDC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|