C10H6FN3O3 — CID 143990076
5-(5-fluorofuro[2,3-c]pyridin-2-yl)imidazolidine-2,4-dione (PubChem CID 143990076) has the molecular formula C10H6FN3O3 and a molecular weight of 235.17 g/mol. Its IUPAC name is 5-(5-fluorofuro[2,3-c]pyridin-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-(5-fluorofuro[2,3-c]pyridin-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143990076 |
| Molecular Formula | C10H6FN3O3 |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 5-(5-fluorofuro[2,3-c]pyridin-2-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2cc3cc(F)ncc3o2)N1 |
| InChI | InChI=1S/C10H6FN3O3/c11-7-2-4-1-5(17-6(4)3-12-7)8-9(15)14-10(16)13-8/h1-3,8H,(H2,13,14,15,16) |
| InChIKey | WHWJEIYDGJUJIL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|