C14H11N5O5 — CID 143990247
5-[2-(2,5-dioxoimidazolidin-4-yl)furo[2,3-b]pyridin-5-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 143990247) has the molecular formula C14H11N5O5 and a molecular weight of 329.27 g/mol. Its IUPAC name is 5-[2-(2,5-dioxoimidazolidin-4-yl)furo[2,3-b]pyridin-5-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[2-(2,5-dioxoimidazolidin-4-yl)furo[2,3-b]pyridin-5-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143990247 |
| Molecular Formula | C14H11N5O5 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 5-[2-(2,5-dioxoimidazolidin-4-yl)furo[2,3-b]pyridin-5-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2cnc3oc(C4NC(=O)NC4=O)cc3c2)NC(=O)NC1=O |
| InChI | InChI=1S/C14H11N5O5/c1-14(11(21)18-13(23)19-14)6-2-5-3-7(24-10(5)15-4-6)8-9(20)17-12(22)16-8/h2-4,8H,1H3,(H2,16,17,20,22)(H2,18,19,21,23) |
| InChIKey | PKIPMLSKBKBQPZ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|