About 4-ethyl-2-methylhexa-2,3-diene
4-ethyl-2-methylhexa-2,3-diene (PubChem CID 14399059) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is 4-ethyl-2-methylhexa-2,3-diene.
Molecular Properties
| Compound Name | 4-ethyl-2-methylhexa-2,3-diene |
| PubChem CID | 14399059 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 4-ethyl-2-methylhexa-2,3-diene |
| SMILES | CCC(=C=C(C)C)CC |
| InChI | InChI=1S/C9H16/c1-5-9(6-2)7-8(3)4/h5-6H2,1-4H3 |
| InChIKey | MUSWJULCPPEBDV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethyl-2-methylhexa-2,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylhexa-2,3-diene?
The IUPAC name of 4-ethyl-2-methylhexa-2,3-diene (CID 14399059) is 4-ethyl-2-methylhexa-2,3-diene.
What is the SMILES notation for 4-ethyl-2-methylhexa-2,3-diene?
The canonical SMILES for 4-ethyl-2-methylhexa-2,3-diene is CCC(=C=C(C)C)CC.
What is the InChIKey of 4-ethyl-2-methylhexa-2,3-diene?
The InChIKey is MUSWJULCPPEBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16/c1-5-9(6-2)7-8(3)4/h5-6H2,1-4H3.
What are the key properties of 4-ethyl-2-methylhexa-2,3-diene?
4-ethyl-2-methylhexa-2,3-diene has a molecular weight of 124.23 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylhexa-2,3-diene is sourced from PubChem (CID 14399059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).