C29H34FN5O5 — CID 143991041
N-ethyl-2-fluoro-3-methoxy-6-methylbenzamide;5-[2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 143991041) has the molecular formula C29H34FN5O5 and a molecular weight of 551.62 g/mol. Its IUPAC name is N-ethyl-2-fluoro-3-methoxy-6-methylbenzamide;5-[2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | N-ethyl-2-fluoro-3-methoxy-6-methylbenzamide;5-[2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143991041 |
| Molecular Formula | C29H34FN5O5 |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | N-ethyl-2-fluoro-3-methoxy-6-methylbenzamide;5-[2-[4-(4-ethylpiperazine-1-carbonyl)phenyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | CCN1CCN(C(=O)c2ccc(C#CC3NC(=O)NC3=O)cc2)CC1.CCNC(=O)c1c(C)ccc(OC)c1F |
| InChI | InChI=1S/C18H20N4O3.C11H14FNO2/c1-2-21-9-11-22(12-10-21)17(24)14-6-3-13(4-7-14)5-8-15-16(23)20-18(25)19-15;1-4-13-11(14)9-7(2)5-6-8(15-3)10(9)12/h3-4,6-7,15H,2,9-12H2,1H3,(H2,19,20,23,25);5-6H,4H2,1-3H3,(H,13,14) |
| InChIKey | CTFVILUSCZRNOO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|