C13H9F3N2O4 — CID 143991138
5-[2-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 143991138) has the molecular formula C13H9F3N2O4 and a molecular weight of 314.22 g/mol. Its IUPAC name is 5-[2-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143991138 |
| Molecular Formula | C13H9F3N2O4 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-[2-[4-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C#Cc2ccc(C(O)(O)C(F)(F)F)cc2)N1 |
| InChI | InChI=1S/C13H9F3N2O4/c14-13(15,16)12(21,22)8-4-1-7(2-5-8)3-6-9-10(19)18-11(20)17-9/h1-2,4-5,9,21-22H,(H2,17,18,19,20) |
| InChIKey | VUTJEUXZFUFRTB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|