About 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one
6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one (PubChem CID 143991262) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one.
Molecular Properties
| Compound Name | 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one |
| PubChem CID | 143991262 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one |
| SMILES | COC1=CCC2=C(C=C1)CN(C)C2=O |
| InChI | InChI=1S/C11H13NO2/c1-12-7-8-3-4-9(14-2)5-6-10(8)11(12)13/h3-5H,6-7H2,1-2H3 |
| InChIKey | ADASLEPSRJJATQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one?
The IUPAC name of 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one (CID 143991262) is 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one.
What is the SMILES notation for 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one?
The canonical SMILES for 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one is COC1=CCC2=C(C=C1)CN(C)C2=O.
What is the InChIKey of 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one?
The InChIKey is ADASLEPSRJJATQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-12-7-8-3-4-9(14-2)5-6-10(8)11(12)13/h3-5H,6-7H2,1-2H3.
What are the key properties of 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one?
6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one has a molecular weight of 191.23 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-methyl-3,8-dihydrocyclohepta[c]pyrrol-1-one is sourced from PubChem (CID 143991262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).