About 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one
4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one (PubChem CID 143991415) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 143991415 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one |
| SMILES | C=C/C(=C\C1=C(C)CNC1=O)OC |
| InChI | InChI=1S/C10H13NO2/c1-4-8(13-3)5-9-7(2)6-11-10(9)12/h4-5H,1,6H2,2-3H3,(H,11,12)/b8-5+ |
| InChIKey | VIJWGOZWAXEHPG-VMPITWQZSA-N |
| XLogP | 1.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one (CID 143991415) is 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one is C=C/C(=C\C1=C(C)CNC1=O)OC.
What is the InChIKey of 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one?
The InChIKey is VIJWGOZWAXEHPG-VMPITWQZSA-N. The full InChI is InChI=1S/C10H13NO2/c1-4-8(13-3)5-9-7(2)6-11-10(9)12/h4-5H,1,6H2,2-3H3,(H,11,12)/b8-5+.
What are the key properties of 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one?
4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one has a molecular weight of 179.22 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E)-2-methoxybuta-1,3-dienyl]-3-methyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 143991415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).