About ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol
ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol (PubChem CID 143992014) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol |
| PubChem CID | 143992014 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol |
| SMILES | C=C/C=C(\C=C)CN1CCC(O)C1.CC |
| InChI | InChI=1S/C11H17NO.C2H6/c1-3-5-10(4-2)8-12-7-6-11(13)9-12;1-2/h3-5,11,13H,1-2,6-9H2;1-2H3/b10-5+; |
| InChIKey | XHAPUKYQZRUKAP-OAZHBLANSA-N |
| XLogP | 2.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol?
The IUPAC name of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol (CID 143992014) is ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol.
What is the SMILES notation for ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol?
The canonical SMILES for ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol is C=C/C=C(\C=C)CN1CCC(O)C1.CC.
What is the InChIKey of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol?
The InChIKey is XHAPUKYQZRUKAP-OAZHBLANSA-N. The full InChI is InChI=1S/C11H17NO.C2H6/c1-3-5-10(4-2)8-12-7-6-11(13)9-12;1-2/h3-5,11,13H,1-2,6-9H2;1-2H3/b10-5+;.
What are the key properties of ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol?
ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol has a molecular weight of 209.33 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(2E)-2-ethenylpenta-2,4-dienyl]pyrrolidin-3-ol is sourced from PubChem (CID 143992014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).