C39H74N4 — CID 143992124
2-[2-[methyl-[(10Z,13Z,25Z)-23-methylcyclotetratriaconta-10,13,25-trien-1-yl]amino]ethyl]guanidine (PubChem CID 143992124) has the molecular formula C39H74N4 and a molecular weight of 599.05 g/mol. Its IUPAC name is 2-[2-[methyl-[(10Z,13Z,25Z)-23-methylcyclotetratriaconta-10,13,25-trien-1-yl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[methyl-[(10Z,13Z,25Z)-23-methylcyclotetratriaconta-10,13,25-trien-1-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 143992124 |
| Molecular Formula | C39H74N4 |
| Molecular Weight | 599.05 g/mol |
| Exact Mass | 598.59 |
| IUPAC Name | 2-[2-[methyl-[(10Z,13Z,25Z)-23-methylcyclotetratriaconta-10,13,25-trien-1-yl]amino]ethyl]guanidine |
| SMILES | CC1C/C=C\CCCCCCCCC(N(C)CCN=C(N)N)CCCCCCCC/C=C\C/C=C\CCCCCCCC1 |
| InChI | InChI=1S/C39H74N4/c1-37-31-27-23-19-15-12-10-8-6-4-3-5-7-9-11-13-17-21-25-29-33-38(43(2)36-35-42-39(40)41)34-30-26-22-18-14-16-20-24-28-32-37/h4-7,24,28,37-38H,3,8-23,25-27,29-36H2,1-2H3,(H4,40,41,42)/b6-4-,7-5-,28-24- |
| InChIKey | JVKQTAAYINKPRF-XCDZNYJTSA-N |
| XLogP | 11.02 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.05 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|