C15H14O4 — CID 143992142
benzene;5,7-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 143992142) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is benzene;5,7-dihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | benzene;5,7-dihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 143992142 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | benzene;5,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2cc(O)cc(O)c21.c1ccccc1 |
| InChI | InChI=1S/C9H8O4.C6H6/c10-5-3-7(12)9-6(11)1-2-13-8(9)4-5;1-2-4-6-5-3-1/h3-4,10,12H,1-2H2;1-6H |
| InChIKey | VXVOMLQZMZVNQG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |