C31H39F3N4O3 — CID 143992714
1-[3-(5-ethyl-2-pyridinyl)propyl]piperidin-4-ol;methyl 3-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethenyl]-2H-pyrrole-5-carboximidate (PubChem CID 143992714) has the molecular formula C31H39F3N4O3 and a molecular weight of 572.67 g/mol. Its IUPAC name is 1-[3-(5-ethyl-2-pyridinyl)propyl]piperidin-4-ol;methyl 3-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethenyl]-2H-pyrrole-5-carboximidate.
| Compound Name | 1-[3-(5-ethyl-2-pyridinyl)propyl]piperidin-4-ol;methyl 3-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethenyl]-2H-pyrrole-5-carboximidate |
|---|---|
| PubChem CID | 143992714 |
| Molecular Formula | C31H39F3N4O3 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 1-[3-(5-ethyl-2-pyridinyl)propyl]piperidin-4-ol;methyl 3-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethenyl]-2H-pyrrole-5-carboximidate |
| SMILES | C=C(/N=C(\OC)C1=NCC(C)=C1)c1ccc(OC(F)(F)F)cc1.CCc1ccc(CCCN2CCC(O)CC2)nc1 |
| InChI | InChI=1S/C16H15F3N2O2.C15H24N2O/c1-10-8-14(20-9-10)15(22-3)21-11(2)12-4-6-13(7-5-12)23-16(17,18)19;1-2-13-5-6-14(16-12-13)4-3-9-17-10-7-15(18)8-11-17/h4-8H,2,9H2,1,3H3;5-6,12,15,18H,2-4,7-11H2,1H3/b21-15-; |
| InChIKey | GIFYJEUKCMRMNK-XGRJIHFXSA-N |
| XLogP | 6.03 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|