C24H23FN2O3S — CID 143993130
2-[6-fluoro-3-methyl-4-(4-phenylsulfanylpiperazine-1-carbonyl)naphthalen-2-yl]acetic acid (PubChem CID 143993130) has the molecular formula C24H23FN2O3S and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-[6-fluoro-3-methyl-4-(4-phenylsulfanylpiperazine-1-carbonyl)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-methyl-4-(4-phenylsulfanylpiperazine-1-carbonyl)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 143993130 |
| Molecular Formula | C24H23FN2O3S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-[6-fluoro-3-methyl-4-(4-phenylsulfanylpiperazine-1-carbonyl)naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1C(=O)N1CCN(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C24H23FN2O3S/c1-16-18(14-22(28)29)13-17-7-8-19(25)15-21(17)23(16)24(30)26-9-11-27(12-10-26)31-20-5-3-2-4-6-20/h2-8,13,15H,9-12,14H2,1H3,(H,28,29) |
| InChIKey | UCEPLHHTINRRIX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|