C9H19IO3S — CID 143993341
(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethane;methoxy thiohypoiodite (PubChem CID 143993341) has the molecular formula C9H19IO3S and a molecular weight of 334.22 g/mol. Its IUPAC name is (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethane;methoxy thiohypoiodite.
| Compound Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethane;methoxy thiohypoiodite |
|---|---|
| PubChem CID | 143993341 |
| Molecular Formula | C9H19IO3S |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;ethane;methoxy thiohypoiodite |
| SMILES | C1C[C@H]2OCC[C@H]2O1.CC.COSI |
| InChI | InChI=1S/C6H10O2.C2H6.CH3IOS/c1-3-7-6-2-4-8-5(1)6;1-2;1-3-4-2/h5-6H,1-4H2;1-2H3;1H3/t5-,6-;;/m1../s1 |
| InChIKey | CPDFUTIZOTXYDJ-BNTLRKBRSA-N |
| XLogP | 3.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|