About N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane
N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane (PubChem CID 143993393) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane.
Molecular Properties
| Compound Name | N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane |
| PubChem CID | 143993393 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane |
| SMILES | CC.CC(C)c1ccc(/N=C/N=C/N)cc1 |
| InChI | InChI=1S/C11H15N3.C2H6/c1-9(2)10-3-5-11(6-4-10)14-8-13-7-12;1-2/h3-9H,1-2H3,(H2,12,13,14);1-2H3 |
| InChIKey | SZNBMJQWDDHLJN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane?
The IUPAC name of N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane (CID 143993393) is N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane.
What is the SMILES notation for N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane?
The canonical SMILES for N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane is CC.CC(C)c1ccc(/N=C/N=C/N)cc1.
What is the InChIKey of N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane?
The InChIKey is SZNBMJQWDDHLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3.C2H6/c1-9(2)10-3-5-11(6-4-10)14-8-13-7-12;1-2/h3-9H,1-2H3,(H2,12,13,14);1-2H3.
What are the key properties of N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane?
N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane has a molecular weight of 219.33 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(aminomethylidene)-N'-(4-propan-2-ylphenyl)methanimidamide;ethane is sourced from PubChem (CID 143993393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).