C16H24N2O — CID 143994163
N,4-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]pent-3-enamide;ethane (PubChem CID 143994163) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N,4-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]pent-3-enamide;ethane.
| Compound Name | N,4-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]pent-3-enamide;ethane |
|---|---|
| PubChem CID | 143994163 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N,4-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]pent-3-enamide;ethane |
| SMILES | C=C1C=CC=C/C1=N\C(CC(=O)NC)=C(C)C.CC |
| InChI | InChI=1S/C14H18N2O.C2H6/c1-10(2)13(9-14(17)15-4)16-12-8-6-5-7-11(12)3;1-2/h5-8H,3,9H2,1-2,4H3,(H,15,17);1-2H3/b16-12+; |
| InChIKey | MHMFDXHOSLIYRI-CLNHMMGSSA-N |
| XLogP | 3.57 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|