C29H35ClF2N6O2 — CID 143994186
5-[(2-chloro-3,6-difluorophenyl)methyl]-3-methyl-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine;4-methyl-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 143994186) has the molecular formula C29H35ClF2N6O2 and a molecular weight of 573.09 g/mol. Its IUPAC name is 5-[(2-chloro-3,6-difluorophenyl)methyl]-3-methyl-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine;4-methyl-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 5-[(2-chloro-3,6-difluorophenyl)methyl]-3-methyl-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine;4-methyl-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 143994186 |
| Molecular Formula | C29H35ClF2N6O2 |
| Molecular Weight | 573.09 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 5-[(2-chloro-3,6-difluorophenyl)methyl]-3-methyl-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine;4-methyl-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCCN2CCOCC2)cc1.Cc1cnc2c(n1)N(Cc1c(F)ccc(F)c1Cl)CCCN2 |
| InChI | InChI=1S/C15H15ClF2N4.C14H20N2O2/c1-9-7-20-14-15(21-9)22(6-2-5-19-14)8-10-11(17)3-4-12(18)13(10)16;1-12-2-4-13(5-3-12)14(17)15-6-7-16-8-10-18-11-9-16/h3-4,7H,2,5-6,8H2,1H3,(H,19,20);2-5H,6-11H2,1H3,(H,15,17) |
| InChIKey | BVMSTEWHEWTAOH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.09 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|