C28H34N4O3 — CID 143994491
N-(5-tert-butylcyclohepta-1,4,6-trien-1-yl)-6-(4-phenylpiperazin-1-yl)pyridine-3-carboxamide;formic acid (PubChem CID 143994491) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-(5-tert-butylcyclohepta-1,4,6-trien-1-yl)-6-(4-phenylpiperazin-1-yl)pyridine-3-carboxamide;formic acid.
| Compound Name | N-(5-tert-butylcyclohepta-1,4,6-trien-1-yl)-6-(4-phenylpiperazin-1-yl)pyridine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 143994491 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | N-(5-tert-butylcyclohepta-1,4,6-trien-1-yl)-6-(4-phenylpiperazin-1-yl)pyridine-3-carboxamide;formic acid |
| SMILES | CC(C)(C)C1=CCC=C(NC(=O)c2ccc(N3CCN(c4ccccc4)CC3)nc2)C=C1.O=CO |
| InChI | InChI=1S/C27H32N4O.CH2O2/c1-27(2,3)22-8-7-9-23(14-13-22)29-26(32)21-12-15-25(28-20-21)31-18-16-30(17-19-31)24-10-5-4-6-11-24;2-1-3/h4-6,8-15,20H,7,16-19H2,1-3H3,(H,29,32);1H,(H,2,3) |
| InChIKey | SUAYDSPKRGSYNJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|