C27H35N3O5 — CID 143994894
5-[3-[[(4-methoxybenzoyl)amino]methyl]phenyl]-N-(2-oxoethyl)furan-2-carboxamide;N-methylmethanamine;propane (PubChem CID 143994894) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is 5-[3-[[(4-methoxybenzoyl)amino]methyl]phenyl]-N-(2-oxoethyl)furan-2-carboxamide;N-methylmethanamine;propane.
| Compound Name | 5-[3-[[(4-methoxybenzoyl)amino]methyl]phenyl]-N-(2-oxoethyl)furan-2-carboxamide;N-methylmethanamine;propane |
|---|---|
| PubChem CID | 143994894 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 5-[3-[[(4-methoxybenzoyl)amino]methyl]phenyl]-N-(2-oxoethyl)furan-2-carboxamide;N-methylmethanamine;propane |
| SMILES | CCC.CNC.COc1ccc(C(=O)NCc2cccc(-c3ccc(C(=O)NCC=O)o3)c2)cc1 |
| InChI | InChI=1S/C22H20N2O5.C3H8.C2H7N/c1-28-18-7-5-16(6-8-18)21(26)24-14-15-3-2-4-17(13-15)19-9-10-20(29-19)22(27)23-11-12-25;2*1-3-2/h2-10,12-13H,11,14H2,1H3,(H,23,27)(H,24,26);3H2,1-2H3;3H,1-2H3 |
| InChIKey | KGPTULMAGZYFER-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|