About 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine
1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine (PubChem CID 143994958) has the molecular formula C14H17FN4
and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine |
| PubChem CID | 143994958 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine |
| SMILES | Cc1c(-c2ccc(F)cc2)nnc(C(N)CN)c1C |
| InChI | InChI=1S/C14H17FN4/c1-8-9(2)14(12(17)7-16)19-18-13(8)10-3-5-11(15)6-4-10/h3-6,12H,7,16-17H2,1-2H3 |
| InChIKey | BOGIAJIKCCJIRU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine?
The IUPAC name of 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine (CID 143994958) is 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine.
What is the SMILES notation for 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine?
The canonical SMILES for 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine is Cc1c(-c2ccc(F)cc2)nnc(C(N)CN)c1C.
What is the InChIKey of 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine?
The InChIKey is BOGIAJIKCCJIRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN4/c1-8-9(2)14(12(17)7-16)19-18-13(8)10-3-5-11(15)6-4-10/h3-6,12H,7,16-17H2,1-2H3.
What are the key properties of 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine?
1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine has a molecular weight of 260.32 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(4-fluorophenyl)-4,5-dimethylpyridazin-3-yl]ethane-1,2-diamine is sourced from PubChem (CID 143994958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).