About 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine
4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine (PubChem CID 143995125) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine.
Molecular Properties
| Compound Name | 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine |
| PubChem CID | 143995125 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine |
| SMILES | CCCNC1=CCC(Cl)=CC=C1OC |
| InChI | InChI=1S/C11H16ClNO/c1-3-8-13-10-6-4-9(12)5-7-11(10)14-2/h5-7,13H,3-4,8H2,1-2H3 |
| InChIKey | UBASKLPUSZWWTB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine (CID 143995125) is 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine is CCCNC1=CCC(Cl)=CC=C1OC.
What is the InChIKey of 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine?
The InChIKey is UBASKLPUSZWWTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClNO/c1-3-8-13-10-6-4-9(12)5-7-11(10)14-2/h5-7,13H,3-4,8H2,1-2H3.
What are the key properties of 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine?
4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine has a molecular weight of 213.71 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-methoxy-N-propylcyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 143995125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).