C28H39N5O — CID 143995212
5-[(2,6-dimethylanilino)methyl]-2-[(4E,6Z)-9,9-dimethyldeca-1,4,6-trien-5-yl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one;ethane (PubChem CID 143995212) has the molecular formula C28H39N5O and a molecular weight of 461.65 g/mol. Its IUPAC name is 5-[(2,6-dimethylanilino)methyl]-2-[(4E,6Z)-9,9-dimethyldeca-1,4,6-trien-5-yl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one;ethane.
| Compound Name | 5-[(2,6-dimethylanilino)methyl]-2-[(4E,6Z)-9,9-dimethyldeca-1,4,6-trien-5-yl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one;ethane |
|---|---|
| PubChem CID | 143995212 |
| Molecular Formula | C28H39N5O |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | 5-[(2,6-dimethylanilino)methyl]-2-[(4E,6Z)-9,9-dimethyldeca-1,4,6-trien-5-yl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one;ethane |
| SMILES | C=CC/C=C(\C=C/CC(C)(C)C)c1nc2nc(CNc3c(C)cccc3C)cc(=O)n2[nH]1.CC |
| InChI | InChI=1S/C26H33N5O.C2H6/c1-7-8-13-20(14-10-15-26(4,5)6)24-29-25-28-21(16-22(32)31(25)30-24)17-27-23-18(2)11-9-12-19(23)3;1-2/h7,9-14,16,27H,1,8,15,17H2,2-6H3,(H,28,29,30);1-2H3/b14-10-,20-13+; |
| InChIKey | MAQQDIWBHDOOEH-KSYDZQSVSA-N |
| XLogP | 6.62 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|