C19H23N5O2 — CID 143995435
2-cyclohepta-1,3,5-trien-1-yl-5-[(1-methylpiperidin-4-yl)oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 143995435) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-cyclohepta-1,3,5-trien-1-yl-5-[(1-methylpiperidin-4-yl)oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-cyclohepta-1,3,5-trien-1-yl-5-[(1-methylpiperidin-4-yl)oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 143995435 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-cyclohepta-1,3,5-trien-1-yl-5-[(1-methylpiperidin-4-yl)oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CN1CCC(OCc2cc(=O)n3[nH]c(C4=CC=CC=CC4)nc3n2)CC1 |
| InChI | InChI=1S/C19H23N5O2/c1-23-10-8-16(9-11-23)26-13-15-12-17(25)24-19(20-15)21-18(22-24)14-6-4-2-3-5-7-14/h2-6,12,16H,7-11,13H2,1H3,(H,20,21,22) |
| InChIKey | JEGIRQMOHQKWMT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |