C16H18N4O2 — CID 143995504
5-[[(1E,4Z,6Z)-5-ethylcycloocta-1,4,6-trien-1-yl]oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 143995504) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-[[(1E,4Z,6Z)-5-ethylcycloocta-1,4,6-trien-1-yl]oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[[(1E,4Z,6Z)-5-ethylcycloocta-1,4,6-trien-1-yl]oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 143995504 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-[[(1E,4Z,6Z)-5-ethylcycloocta-1,4,6-trien-1-yl]oxymethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCC1=C/C/C=C(/OCc2cc(=O)n3[nH]cnc3n2)C/C=C\1 |
| InChI | InChI=1S/C16H18N4O2/c1-2-12-5-3-7-14(8-4-6-12)22-10-13-9-15(21)20-16(19-13)17-11-18-20/h3,5-6,8-9,11H,2,4,7,10H2,1H3,(H,17,18,19)/b5-3-,12-6-,14-8+ |
| InChIKey | QETYOSDKXMONQR-YUKQWRBPSA-N |
| XLogP | 2.50 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |