C16H23N3 — CID 143996174
4-[[(5S)-2-azabicyclo[3.3.2]decan-2-yl]methyl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 143996174) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-[[(5S)-2-azabicyclo[3.3.2]decan-2-yl]methyl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-[[(5S)-2-azabicyclo[3.3.2]decan-2-yl]methyl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 143996174 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 4-[[(5S)-2-azabicyclo[3.3.2]decan-2-yl]methyl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C=C(CN2CC[C@H]3CCCC2CC3)C=C/C1=N\[H] |
| InChI | InChI=1S/C16H23N3/c17-15-7-5-13(10-16(15)18)11-19-9-8-12-2-1-3-14(19)6-4-12/h5,7,10,12,14,17-18H,1-4,6,8-9,11H2/b17-15+,18-16-/t12-,14?/m0/s1 |
| InChIKey | YRVXEKWFBQPREI-RMJCTUQRSA-N |
| XLogP | 3.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|