About ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide
ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide (PubChem CID 143996237) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide.
Molecular Properties
| Compound Name | ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide |
| PubChem CID | 143996237 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide |
| SMILES | C=C/C=C(\C=C)CNC(C)=O.CC |
| InChI | InChI=1S/C9H13NO.C2H6/c1-4-6-9(5-2)7-10-8(3)11;1-2/h4-6H,1-2,7H2,3H3,(H,10,11);1-2H3/b9-6+; |
| InChIKey | GXXVZYMJIPOVDP-MLBSPLJJSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide?
The IUPAC name of ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide (CID 143996237) is ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide.
What is the SMILES notation for ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide?
The canonical SMILES for ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide is C=C/C=C(\C=C)CNC(C)=O.CC.
What is the InChIKey of ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide?
The InChIKey is GXXVZYMJIPOVDP-MLBSPLJJSA-N. The full InChI is InChI=1S/C9H13NO.C2H6/c1-4-6-9(5-2)7-10-8(3)11;1-2/h4-6H,1-2,7H2,3H3,(H,10,11);1-2H3/b9-6+;.
What are the key properties of ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide?
ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide has a molecular weight of 181.28 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]acetamide is sourced from PubChem (CID 143996237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).