About 3-methoxy-N,2,5-trimethylpyridin-4-amine
3-methoxy-N,2,5-trimethylpyridin-4-amine (PubChem CID 143996352) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-methoxy-N,2,5-trimethylpyridin-4-amine.
Molecular Properties
| Compound Name | 3-methoxy-N,2,5-trimethylpyridin-4-amine |
| PubChem CID | 143996352 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-methoxy-N,2,5-trimethylpyridin-4-amine |
| SMILES | CNc1c(C)cnc(C)c1OC |
| InChI | InChI=1S/C9H14N2O/c1-6-5-11-7(2)9(12-4)8(6)10-3/h5H,1-4H3,(H,10,11) |
| InChIKey | AFTGDNDDAGVQTH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-N,2,5-trimethylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,2,5-trimethylpyridin-4-amine?
The IUPAC name of 3-methoxy-N,2,5-trimethylpyridin-4-amine (CID 143996352) is 3-methoxy-N,2,5-trimethylpyridin-4-amine.
What is the SMILES notation for 3-methoxy-N,2,5-trimethylpyridin-4-amine?
The canonical SMILES for 3-methoxy-N,2,5-trimethylpyridin-4-amine is CNc1c(C)cnc(C)c1OC.
What is the InChIKey of 3-methoxy-N,2,5-trimethylpyridin-4-amine?
The InChIKey is AFTGDNDDAGVQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-6-5-11-7(2)9(12-4)8(6)10-3/h5H,1-4H3,(H,10,11).
What are the key properties of 3-methoxy-N,2,5-trimethylpyridin-4-amine?
3-methoxy-N,2,5-trimethylpyridin-4-amine has a molecular weight of 166.22 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,2,5-trimethylpyridin-4-amine is sourced from PubChem (CID 143996352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).