About ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine
ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine (PubChem CID 143996448) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine.
Molecular Properties
| Compound Name | ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine |
| PubChem CID | 143996448 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine |
| SMILES | C=Cc1c(C)cnc(C)c1CC.CC |
| InChI | InChI=1S/C11H15N.C2H6/c1-5-10-8(3)7-12-9(4)11(10)6-2;1-2/h5,7H,1,6H2,2-4H3;1-2H3 |
| InChIKey | SLJAVHSXXWPIFG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine?
The IUPAC name of ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine (CID 143996448) is ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine.
What is the SMILES notation for ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine?
The canonical SMILES for ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine is C=Cc1c(C)cnc(C)c1CC.CC.
What is the InChIKey of ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine?
The InChIKey is SLJAVHSXXWPIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C2H6/c1-5-10-8(3)7-12-9(4)11(10)6-2;1-2/h5,7H,1,6H2,2-4H3;1-2H3.
What are the key properties of ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine?
ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine has a molecular weight of 191.32 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethenyl-3-ethyl-2,5-dimethylpyridine is sourced from PubChem (CID 143996448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).