C36H60N4S — CID 143996624
4-[(2E,6E,10E)-3,7-dimethyl-11-[2-(methylamino)hex-1-en-3-ylamino]dodeca-2,6,10-trienyl]sulfanyl-3-(4-methylhexa-1,5-dien-2-ylamino)-2-methylidenebutanenitrile;prop-1-ene (PubChem CID 143996624) has the molecular formula C36H60N4S and a molecular weight of 580.97 g/mol. Its IUPAC name is 4-[(2E,6E,10E)-3,7-dimethyl-11-[2-(methylamino)hex-1-en-3-ylamino]dodeca-2,6,10-trienyl]sulfanyl-3-(4-methylhexa-1,5-dien-2-ylamino)-2-methylidenebutanenitrile;prop-1-ene.
| Compound Name | 4-[(2E,6E,10E)-3,7-dimethyl-11-[2-(methylamino)hex-1-en-3-ylamino]dodeca-2,6,10-trienyl]sulfanyl-3-(4-methylhexa-1,5-dien-2-ylamino)-2-methylidenebutanenitrile;prop-1-ene |
|---|---|
| PubChem CID | 143996624 |
| Molecular Formula | C36H60N4S |
| Molecular Weight | 580.97 g/mol |
| Exact Mass | 580.45 |
| IUPAC Name | 4-[(2E,6E,10E)-3,7-dimethyl-11-[2-(methylamino)hex-1-en-3-ylamino]dodeca-2,6,10-trienyl]sulfanyl-3-(4-methylhexa-1,5-dien-2-ylamino)-2-methylidenebutanenitrile;prop-1-ene |
| SMILES | C=CC.C=CC(C)CC(=C)NC(CSC/C=C(\C)CC/C=C(\C)CC/C=C(\C)NC(CCC)C(=C)NC)C(=C)C#N |
| InChI | InChI=1S/C33H54N4S.C3H6/c1-11-15-32(31(9)35-10)36-29(7)19-14-18-26(4)16-13-17-27(5)20-21-38-24-33(28(6)23-34)37-30(8)22-25(3)12-2;1-3-2/h12,16,19-20,25,32-33,35-37H,2,6,8-9,11,13-15,17-18,21-22,24H2,1,3-5,7,10H3;3H,1H2,2H3/b26-16+,27-20+,29-19+; |
| InChIKey | AIHLQVMEGTYWIJ-MQIUOBFTSA-N |
| XLogP | 9.52 |
| TPSA | 59.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.97 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|