C20H36N2S — CID 143996660
1-[(2Z,6E)-7,11-dimethyl-1-(2-methylpropylsulfanyl)dodeca-2,6,10-trien-3-yl]-2-ethenylhydrazine (PubChem CID 143996660) has the molecular formula C20H36N2S and a molecular weight of 336.59 g/mol. Its IUPAC name is 1-[(2Z,6E)-7,11-dimethyl-1-(2-methylpropylsulfanyl)dodeca-2,6,10-trien-3-yl]-2-ethenylhydrazine.
| Compound Name | 1-[(2Z,6E)-7,11-dimethyl-1-(2-methylpropylsulfanyl)dodeca-2,6,10-trien-3-yl]-2-ethenylhydrazine |
|---|---|
| PubChem CID | 143996660 |
| Molecular Formula | C20H36N2S |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1-[(2Z,6E)-7,11-dimethyl-1-(2-methylpropylsulfanyl)dodeca-2,6,10-trien-3-yl]-2-ethenylhydrazine |
| SMILES | C=CNN/C(=C\CSCC(C)C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H36N2S/c1-7-21-22-20(14-15-23-16-18(4)5)13-9-12-19(6)11-8-10-17(2)3/h7,10,12,14,18,21-22H,1,8-9,11,13,15-16H2,2-6H3/b19-12+,20-14- |
| InChIKey | ZBGCHMKOAXGCQA-XXOHTHHSSA-N |
| XLogP | 5.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|