About [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol
[5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol (PubChem CID 143997256) has the molecular formula C14H22NOP
and a molecular weight of 251.31 g/mol. Its IUPAC name is [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol.
Molecular Properties
| Compound Name | [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol |
| PubChem CID | 143997256 |
| Molecular Formula | C14H22NOP |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol |
| SMILES | CC1C=CC(CO)=C(C2CCN(P)CC2)C=C1 |
| InChI | InChI=1S/C14H22NOP/c1-11-2-4-13(10-16)14(5-3-11)12-6-8-15(17)9-7-12/h2-5,11-12,16H,6-10,17H2,1H3 |
| InChIKey | TUMZFTGDWRQXOW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol?
The IUPAC name of [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol (CID 143997256) is [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol.
What is the SMILES notation for [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol?
The canonical SMILES for [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol is CC1C=CC(CO)=C(C2CCN(P)CC2)C=C1.
What is the InChIKey of [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol?
The InChIKey is TUMZFTGDWRQXOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22NOP/c1-11-2-4-13(10-16)14(5-3-11)12-6-8-15(17)9-7-12/h2-5,11-12,16H,6-10,17H2,1H3.
What are the key properties of [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol?
[5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol has a molecular weight of 251.31 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol is sourced from PubChem (CID 143997256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).