C15H24NOP — CID 143997258
[5,5-dimethyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol (PubChem CID 143997258) has the molecular formula C15H24NOP and a molecular weight of 265.34 g/mol. Its IUPAC name is [5,5-dimethyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol.
| Compound Name | [5,5-dimethyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol |
|---|---|
| PubChem CID | 143997258 |
| Molecular Formula | C15H24NOP |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | [5,5-dimethyl-2-(1-phosphanylpiperidin-4-yl)cyclohepta-1,3,6-trien-1-yl]methanol |
| SMILES | CC1(C)C=CC(CO)=C(C2CCN(P)CC2)C=C1 |
| InChI | InChI=1S/C15H24NOP/c1-15(2)7-3-13(11-17)14(4-8-15)12-5-9-16(18)10-6-12/h3-4,7-8,12,17H,5-6,9-11,18H2,1-2H3 |
| InChIKey | LWWSERFGWGQFIQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|