C26H22ClN7O — CID 143997449
6-[amino-(4-chlorophenyl)methyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one;1-methyltriazole (PubChem CID 143997449) has the molecular formula C26H22ClN7O and a molecular weight of 483.96 g/mol. Its IUPAC name is 6-[amino-(4-chlorophenyl)methyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one;1-methyltriazole.
| Compound Name | 6-[amino-(4-chlorophenyl)methyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one;1-methyltriazole |
|---|---|
| PubChem CID | 143997449 |
| Molecular Formula | C26H22ClN7O |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 6-[amino-(4-chlorophenyl)methyl]-4-(6-ethynyl-2-pyridinyl)-1-methyl-1,5-naphthyridin-2-one;1-methyltriazole |
| SMILES | C#Cc1cccc(-c2cc(=O)n(C)c3ccc(C(N)c4ccc(Cl)cc4)nc23)n1.Cn1ccnn1 |
| InChI | InChI=1S/C23H17ClN4O.C3H5N3/c1-3-16-5-4-6-18(26-16)17-13-21(29)28(2)20-12-11-19(27-23(17)20)22(25)14-7-9-15(24)10-8-14;1-6-3-2-4-5-6/h1,4-13,22H,25H2,2H3;2-3H,1H3 |
| InChIKey | HXPPMIZQZPAZMN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|