C14H25N3 — CID 143997981
5-[(1Z,4E)-4-[2-(methylamino)ethyl]hexa-1,4-dienyl]-1,2,3,4-tetrahydropyridin-6-amine (PubChem CID 143997981) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 5-[(1Z,4E)-4-[2-(methylamino)ethyl]hexa-1,4-dienyl]-1,2,3,4-tetrahydropyridin-6-amine.
| Compound Name | 5-[(1Z,4E)-4-[2-(methylamino)ethyl]hexa-1,4-dienyl]-1,2,3,4-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 143997981 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 5-[(1Z,4E)-4-[2-(methylamino)ethyl]hexa-1,4-dienyl]-1,2,3,4-tetrahydropyridin-6-amine |
| SMILES | C/C=C(\C/C=C\C1=C(N)NCCC1)CCNC |
| InChI | InChI=1S/C14H25N3/c1-3-12(9-11-16-2)6-4-7-13-8-5-10-17-14(13)15/h3-4,7,16-17H,5-6,8-11,15H2,1-2H3/b7-4-,12-3+ |
| InChIKey | DWBMNGJCSPTHJO-PEFLUEAXSA-N |
| XLogP | 2.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|