About 3-methyl-N,7-dipropyl-4H-azepin-2-amine
3-methyl-N,7-dipropyl-4H-azepin-2-amine (PubChem CID 143997990) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-methyl-N,7-dipropyl-4H-azepin-2-amine.
Molecular Properties
| Compound Name | 3-methyl-N,7-dipropyl-4H-azepin-2-amine |
| PubChem CID | 143997990 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 3-methyl-N,7-dipropyl-4H-azepin-2-amine |
| SMILES | CCCNC1=C(C)CC=CC(CCC)=N1 |
| InChI | InChI=1S/C13H22N2/c1-4-7-12-9-6-8-11(3)13(15-12)14-10-5-2/h6,9,14H,4-5,7-8,10H2,1-3H3 |
| InChIKey | YYIJHQUHDSPLTA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-N,7-dipropyl-4H-azepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N,7-dipropyl-4H-azepin-2-amine?
The IUPAC name of 3-methyl-N,7-dipropyl-4H-azepin-2-amine (CID 143997990) is 3-methyl-N,7-dipropyl-4H-azepin-2-amine.
What is the SMILES notation for 3-methyl-N,7-dipropyl-4H-azepin-2-amine?
The canonical SMILES for 3-methyl-N,7-dipropyl-4H-azepin-2-amine is CCCNC1=C(C)CC=CC(CCC)=N1.
What is the InChIKey of 3-methyl-N,7-dipropyl-4H-azepin-2-amine?
The InChIKey is YYIJHQUHDSPLTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-4-7-12-9-6-8-11(3)13(15-12)14-10-5-2/h6,9,14H,4-5,7-8,10H2,1-3H3.
What are the key properties of 3-methyl-N,7-dipropyl-4H-azepin-2-amine?
3-methyl-N,7-dipropyl-4H-azepin-2-amine has a molecular weight of 206.33 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N,7-dipropyl-4H-azepin-2-amine is sourced from PubChem (CID 143997990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).