C26H27N5O4 — CID 143998256
1H-benzimidazol-2-yl-[4-(3-piperidin-1-ylpyrazin-2-yl)oxyphenyl]methanone;ethyl formate (PubChem CID 143998256) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl-[4-(3-piperidin-1-ylpyrazin-2-yl)oxyphenyl]methanone;ethyl formate.
| Compound Name | 1H-benzimidazol-2-yl-[4-(3-piperidin-1-ylpyrazin-2-yl)oxyphenyl]methanone;ethyl formate |
|---|---|
| PubChem CID | 143998256 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 1H-benzimidazol-2-yl-[4-(3-piperidin-1-ylpyrazin-2-yl)oxyphenyl]methanone;ethyl formate |
| SMILES | CCOC=O.O=C(c1ccc(Oc2nccnc2N2CCCCC2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H21N5O2.C3H6O2/c29-20(21-26-18-6-2-3-7-19(18)27-21)16-8-10-17(11-9-16)30-23-22(24-12-13-25-23)28-14-4-1-5-15-28;1-2-5-3-4/h2-3,6-13H,1,4-5,14-15H2,(H,26,27);3H,2H2,1H3 |
| InChIKey | HEYGYHXPAOJNNI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|