C19H23B2N3O4 — CID 143998260
5-(dioxaboriran-3-yl)-2-methylpyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 143998260) has the molecular formula C19H23B2N3O4 and a molecular weight of 379.03 g/mol. Its IUPAC name is 5-(dioxaboriran-3-yl)-2-methylpyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(dioxaboriran-3-yl)-2-methylpyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143998260 |
| Molecular Formula | C19H23B2N3O4 |
| Molecular Weight | 379.03 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 5-(dioxaboriran-3-yl)-2-methylpyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1(C)OB(c2cnc3[nH]ccc3c2)OC1(C)C.Cc1ccc(B2OO2)cn1 |
| InChI | InChI=1S/C13H17BN2O2.C6H6BNO2/c1-12(2)13(3,4)18-14(17-12)10-7-9-5-6-15-11(9)16-8-10;1-5-2-3-6(4-8-5)7-9-10-7/h5-8H,1-4H3,(H,15,16);2-4H,1H3 |
| InChIKey | HVDQAJJVRAHVOS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.03 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|