About CID 143998922
CID 143998922 (PubChem CID 143998922) has the molecular formula C24H18N3O3
and a molecular weight of 396.43 g/mol.
Molecular Properties
| Compound Name | CID 143998922 |
| PubChem CID | 143998922 |
| Molecular Formula | C24H18N3O3 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | — |
| SMILES | CC(=O)c1cnc(Nc2ccc(C3=C[CH]3)cc2)nc1Oc1cccc2c1C(=O)CC2 |
| InChI | InChI=1S/C24H18N3O3/c1-14(28)19-13-25-24(26-18-10-7-16(8-11-18)15-5-6-15)27-23(19)30-21-4-2-3-17-9-12-20(29)22(17)21/h2-8,10-11,13H,9,12H2,1H3,(H,25,26,27) |
| InChIKey | DBWUJDKCJMJNHN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 143998922 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143998922?
The IUPAC name of CID 143998922 (CID 143998922) is not available.
What is the SMILES notation for CID 143998922?
The canonical SMILES for CID 143998922 is CC(=O)c1cnc(Nc2ccc(C3=C[CH]3)cc2)nc1Oc1cccc2c1C(=O)CC2.
What is the InChIKey of CID 143998922?
The InChIKey is DBWUJDKCJMJNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N3O3/c1-14(28)19-13-25-24(26-18-10-7-16(8-11-18)15-5-6-15)27-23(19)30-21-4-2-3-17-9-12-20(29)22(17)21/h2-8,10-11,13H,9,12H2,1H3,(H,25,26,27).
What are the key properties of CID 143998922?
CID 143998922 has a molecular weight of 396.43 g/mol, XLogP of 4.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143998922 is sourced from PubChem (CID 143998922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).