C20H25F3N8O3 — CID 143999045
N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-3-[5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxamide (PubChem CID 143999045) has the molecular formula C20H25F3N8O3 and a molecular weight of 482.47 g/mol. Its IUPAC name is N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-3-[5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-3-[5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 143999045 |
| Molecular Formula | C20H25F3N8O3 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-3-[5-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxamide |
| SMILES | CN(N)/C(=N\N)NC(=O)N1CCC2(CC1)CC(c1noc(-c3ccc(C(F)(F)F)cc3)n1)CO2 |
| InChI | InChI=1S/C20H25F3N8O3/c1-30(25)17(28-24)27-18(32)31-8-6-19(7-9-31)10-13(11-33-19)15-26-16(34-29-15)12-2-4-14(5-3-12)20(21,22)23/h2-5,13H,6-11,24-25H2,1H3,(H,27,28,32) |
| InChIKey | OIAMSURABGWUQH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|