C35H29N7O9 — CID 143999246
2,3-dimethoxy-5-[3-[7-[[2-methoxy-4-(6-methoxy-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)phenoxy]methoxy]-7-azabicyclo[4.1.0]hepta-1(6),2,4-trien-3-yl]-1,2-oxazol-5-yl]benzoyl azide (PubChem CID 143999246) has the molecular formula C35H29N7O9 and a molecular weight of 691.66 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[3-[7-[[2-methoxy-4-(6-methoxy-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)phenoxy]methoxy]-7-azabicyclo[4.1.0]hepta-1(6),2,4-trien-3-yl]-1,2-oxazol-5-yl]benzoyl azide.
| Compound Name | 2,3-dimethoxy-5-[3-[7-[[2-methoxy-4-(6-methoxy-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)phenoxy]methoxy]-7-azabicyclo[4.1.0]hepta-1(6),2,4-trien-3-yl]-1,2-oxazol-5-yl]benzoyl azide |
|---|---|
| PubChem CID | 143999246 |
| Molecular Formula | C35H29N7O9 |
| Molecular Weight | 691.66 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | 2,3-dimethoxy-5-[3-[7-[[2-methoxy-4-(6-methoxy-4-oxo-2,3-dihydro-1H-quinazolin-2-yl)phenoxy]methoxy]-7-azabicyclo[4.1.0]hepta-1(6),2,4-trien-3-yl]-1,2-oxazol-5-yl]benzoyl azide |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCON3c4ccc(-c5cc(-c6cc(OC)c(OC)c(C(=O)N=[N+]=[N-])c6)on5)cc43)c(OC)c1)N2 |
| InChI | InChI=1S/C35H29N7O9/c1-45-21-7-8-24-22(15-21)34(43)38-33(37-24)19-6-10-28(30(13-19)46-2)49-17-50-42-26-9-5-18(12-27(26)42)25-16-29(51-40-25)20-11-23(35(44)39-41-36)32(48-4)31(14-20)47-3/h5-16,33,37H,17H2,1-4H3,(H,38,43) |
| InChIKey | PUUKNARLZVXRAJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 191.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.66 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|