C14H14 — CID 143999658
(3Z,9Z)-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne (PubChem CID 143999658) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is (3Z,9Z)-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne.
| Compound Name | (3Z,9Z)-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne |
|---|---|
| PubChem CID | 143999658 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3Z,9Z)-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne |
| SMILES | C=C/C=C\C(=C)C#CC(=C)/C=C\C=C |
| InChI | InChI=1S/C14H14/c1-5-7-9-13(3)11-12-14(4)10-8-6-2/h5-10H,1-4H2/b9-7-,10-8- |
| InChIKey | AXCNKVHQGZHTRG-XOHWUJONSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|