C21H19F3N6O — CID 143999760
(2Z,4E)-5-[(4-cyano-2-pyridinyl)amino]-2-ethenyl-3-[[4-(trifluoromethyl)-3-pyridinyl]methylamino]hexa-2,4-dienamide (PubChem CID 143999760) has the molecular formula C21H19F3N6O and a molecular weight of 428.42 g/mol. Its IUPAC name is (2Z,4E)-5-[(4-cyano-2-pyridinyl)amino]-2-ethenyl-3-[[4-(trifluoromethyl)-3-pyridinyl]methylamino]hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-5-[(4-cyano-2-pyridinyl)amino]-2-ethenyl-3-[[4-(trifluoromethyl)-3-pyridinyl]methylamino]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 143999760 |
| Molecular Formula | C21H19F3N6O |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (2Z,4E)-5-[(4-cyano-2-pyridinyl)amino]-2-ethenyl-3-[[4-(trifluoromethyl)-3-pyridinyl]methylamino]hexa-2,4-dienamide |
| SMILES | C=C/C(C(N)=O)=C(\C=C(/C)Nc1cc(C#N)ccn1)NCc1cnccc1C(F)(F)F |
| InChI | InChI=1S/C21H19F3N6O/c1-3-16(20(26)31)18(8-13(2)30-19-9-14(10-25)4-7-28-19)29-12-15-11-27-6-5-17(15)21(22,23)24/h3-9,11,29H,1,12H2,2H3,(H2,26,31)(H,28,30)/b13-8+,18-16- |
| InChIKey | CPXQBBLPPAHUCA-UXCAYTPMSA-N |
| XLogP | 3.40 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|