About ethyl 3,8-dioxononanoate
ethyl 3,8-dioxononanoate (PubChem CID 14400113) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl 3,8-dioxononanoate.
Molecular Properties
| Compound Name | ethyl 3,8-dioxononanoate |
| PubChem CID | 14400113 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl 3,8-dioxononanoate |
| SMILES | CCOC(=O)CC(=O)CCCCC(C)=O |
| InChI | InChI=1S/C11H18O4/c1-3-15-11(14)8-10(13)7-5-4-6-9(2)12/h3-8H2,1-2H3 |
| InChIKey | DYUOIOSGEDEYNR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3,8-dioxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,8-dioxononanoate?
The IUPAC name of ethyl 3,8-dioxononanoate (CID 14400113) is ethyl 3,8-dioxononanoate.
What is the SMILES notation for ethyl 3,8-dioxononanoate?
The canonical SMILES for ethyl 3,8-dioxononanoate is CCOC(=O)CC(=O)CCCCC(C)=O.
What is the InChIKey of ethyl 3,8-dioxononanoate?
The InChIKey is DYUOIOSGEDEYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-3-15-11(14)8-10(13)7-5-4-6-9(2)12/h3-8H2,1-2H3.
What are the key properties of ethyl 3,8-dioxononanoate?
ethyl 3,8-dioxononanoate has a molecular weight of 214.26 g/mol, XLogP of 1.66, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,8-dioxononanoate is sourced from PubChem (CID 14400113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).