About (2E)-2-methyl-6-methylideneocta-2,7-dienal
(2E)-2-methyl-6-methylideneocta-2,7-dienal (PubChem CID 14400165) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (2E)-2-methyl-6-methylideneocta-2,7-dienal.
Molecular Properties
| Compound Name | (2E)-2-methyl-6-methylideneocta-2,7-dienal |
| PubChem CID | 14400165 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (2E)-2-methyl-6-methylideneocta-2,7-dienal |
| SMILES | C=CC(=C)CC/C=C(\C)C=O |
| InChI | InChI=1S/C10H14O/c1-4-9(2)6-5-7-10(3)8-11/h4,7-8H,1-2,5-6H2,3H3/b10-7+ |
| InChIKey | NDYNCPVWWPJJKN-JXMROGBWSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-methyl-6-methylideneocta-2,7-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-methyl-6-methylideneocta-2,7-dienal?
The IUPAC name of (2E)-2-methyl-6-methylideneocta-2,7-dienal (CID 14400165) is (2E)-2-methyl-6-methylideneocta-2,7-dienal.
What is the SMILES notation for (2E)-2-methyl-6-methylideneocta-2,7-dienal?
The canonical SMILES for (2E)-2-methyl-6-methylideneocta-2,7-dienal is C=CC(=C)CC/C=C(\C)C=O.
What is the InChIKey of (2E)-2-methyl-6-methylideneocta-2,7-dienal?
The InChIKey is NDYNCPVWWPJJKN-JXMROGBWSA-N. The full InChI is InChI=1S/C10H14O/c1-4-9(2)6-5-7-10(3)8-11/h4,7-8H,1-2,5-6H2,3H3/b10-7+.
What are the key properties of (2E)-2-methyl-6-methylideneocta-2,7-dienal?
(2E)-2-methyl-6-methylideneocta-2,7-dienal has a molecular weight of 150.22 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-methyl-6-methylideneocta-2,7-dienal is sourced from PubChem (CID 14400165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).