C20H23F17 — CID 14400498
(E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroicos-9-ene (PubChem CID 14400498) has the molecular formula C20H23F17 and a molecular weight of 586.37 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroicos-9-ene.
| Compound Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroicos-9-ene |
|---|---|
| PubChem CID | 14400498 |
| Molecular Formula | C20H23F17 |
| Molecular Weight | 586.37 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoroicos-9-ene |
| SMILES | CCCCCCCCCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H23F17/c1-2-3-4-5-6-7-8-9-10-11-12-13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h11-12H,2-10H2,1H3/b12-11+ |
| InChIKey | ZFYUUPVIDOJWAX-VAWYXSNFSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.37 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|