C23H20N2O3 — CID 14401291
4-[(E)-2-(4-oxo-3-oxa-6,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)ethenyl]benzaldehyde (PubChem CID 14401291) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[(E)-2-(4-oxo-3-oxa-6,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)ethenyl]benzaldehyde.
| Compound Name | 4-[(E)-2-(4-oxo-3-oxa-6,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 14401291 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[(E)-2-(4-oxo-3-oxa-6,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-5-yl)ethenyl]benzaldehyde |
| SMILES | O=Cc1ccc(/C=C/c2nc3cc4c5c(c3oc2=O)CCCN5CCC4)cc1 |
| InChI | InChI=1S/C23H20N2O3/c26-14-16-7-5-15(6-8-16)9-10-19-23(27)28-22-18-4-2-12-25-11-1-3-17(21(18)25)13-20(22)24-19/h5-10,13-14H,1-4,11-12H2/b10-9+ |
| InChIKey | LLUWTQOTOMLZHZ-MDZDMXLPSA-N |
| XLogP | 3.87 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|